ChemNet > CAS > 220497-69-8 (S)-2-(Cyclohexylmethyl)succinic acid-1-methyl ester
220497-69-8 (S)-2-(Cyclohexylmethyl)succinic acid-1-methyl ester
produktnavn |
(S)-2-(Cyclohexylmethyl)succinic acid-1-methyl ester |
Synonymer |
(S)-4-Cyclohexyl-3-(methoxycarbonyl)butyric acid; (S)-(-)-2-(Cyclohexylmethyl)succinic acid 1-methyl ester; (S)-4-Methoxy-3-cyclohexylmethyl-4-oxobutanoic Acid; (3S)-3-(cyclohexylmethyl)-4-methoxy-4-oxobutanoic acid |
Molekylær Formel |
C12H20O4 |
Molekylvekt |
228.2848 |
InChI |
InChI=1/C12H20O4/c1-16-12(15)10(8-11(13)14)7-9-5-3-2-4-6-9/h9-10H,2-8H2,1H3,(H,13,14)/t10-/m0/s1 |
CAS-nummer |
220497-69-8 |
Molecular Structure |
|
Tetthet |
1.094g/cm3 |
Kokepunkt |
360.4°C at 760 mmHg |
Brytningsindeks |
1.476 |
Flammepunktet |
133.2°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|